C24H40O3 — CID 72704538
(E)-4-[(1S,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-2-(2,2-diethoxyethyl)but-2-enal (PubChem CID 72704538) has the molecular formula C24H40O3 and a molecular weight of 376.58 g/mol. Its IUPAC name is (E)-4-[(1S,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-2-(2,2-diethoxyethyl)but-2-enal.
| Compound Name | (E)-4-[(1S,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-2-(2,2-diethoxyethyl)but-2-enal |
|---|---|
| PubChem CID | 72704538 |
| Molecular Formula | C24H40O3 |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.30 |
| IUPAC Name | (E)-4-[(1S,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-2-(2,2-diethoxyethyl)but-2-enal |
| SMILES | C=C1CCC2C(C)(C)CCC[C@]2(C)[C@H]1C/C=C(/C=O)CC(OCC)OCC |
| InChI | InChI=1S/C24H40O3/c1-7-26-22(27-8-2)16-19(17-25)11-12-20-18(3)10-13-21-23(4,5)14-9-15-24(20,21)6/h11,17,20-22H,3,7-10,12-16H2,1-2,4-6H3/b19-11+/t20-,21?,24+/m0/s1 |
| InChIKey | ZLJOGSNKODRXJP-OHLXRCEASA-N |
| XLogP | 6.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|