C27H38O3 — CID 100927648
[(Z)-4-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-2-[(1R)-1-hydroxyethyl]but-2-enyl] benzoate (PubChem CID 100927648) has the molecular formula C27H38O3 and a molecular weight of 410.60 g/mol. Its IUPAC name is [(Z)-4-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-2-[(1R)-1-hydroxyethyl]but-2-enyl] benzoate.
| Compound Name | [(Z)-4-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-2-[(1R)-1-hydroxyethyl]but-2-enyl] benzoate |
|---|---|
| PubChem CID | 100927648 |
| Molecular Formula | C27H38O3 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | [(Z)-4-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-2-[(1R)-1-hydroxyethyl]but-2-enyl] benzoate |
| SMILES | C=C1CC[C@H]2C(C)(C)CCC[C@]2(C)[C@H]1C/C=C(/COC(=O)c1ccccc1)[C@@H](C)O |
| InChI | InChI=1S/C27H38O3/c1-19-12-15-24-26(3,4)16-9-17-27(24,5)23(19)14-13-22(20(2)28)18-30-25(29)21-10-7-6-8-11-21/h6-8,10-11,13,20,23-24,28H,1,9,12,14-18H2,2-5H3/b22-13-/t20-,23+,24+,27-/m1/s1 |
| InChIKey | RKFSIBCMVVQDPS-LVLRZYCHSA-N |
| XLogP | 6.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|