C26H38O — CID 102293888
(1R,4aR,4bS,8aS,10aR)-4b,8,8,10a-tetramethyl-2-methylidene-1-(phenoxymethyl)-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthrene (PubChem CID 102293888) has the molecular formula C26H38O and a molecular weight of 366.59 g/mol. Its IUPAC name is (1R,4aR,4bS,8aS,10aR)-4b,8,8,10a-tetramethyl-2-methylidene-1-(phenoxymethyl)-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthrene.
| Compound Name | (1R,4aR,4bS,8aS,10aR)-4b,8,8,10a-tetramethyl-2-methylidene-1-(phenoxymethyl)-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthrene |
|---|---|
| PubChem CID | 102293888 |
| Molecular Formula | C26H38O |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.29 |
| IUPAC Name | (1R,4aR,4bS,8aS,10aR)-4b,8,8,10a-tetramethyl-2-methylidene-1-(phenoxymethyl)-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthrene |
| SMILES | C=C1CC[C@H]2[C@@](C)(CC[C@H]3C(C)(C)CCC[C@]23C)[C@@H]1COc1ccccc1 |
| InChI | InChI=1S/C26H38O/c1-19-12-13-23-25(4,21(19)18-27-20-10-7-6-8-11-20)17-14-22-24(2,3)15-9-16-26(22,23)5/h6-8,10-11,21-23H,1,9,12-18H2,2-5H3/t21-,22+,23+,25+,26+/m1/s1 |
| InChIKey | QXQPMMGIWLVXIC-FEVZJFHWSA-N |
| XLogP | 7.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|