C21H41OSi- — CID 159817913
[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methoxy-tert-butyl-dimethylsilanuide (PubChem CID 159817913) has the molecular formula C21H41OSi- and a molecular weight of 337.64 g/mol. Its IUPAC name is [(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methoxy-tert-butyl-dimethylsilanuide.
| Compound Name | [(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methoxy-tert-butyl-dimethylsilanuide |
|---|---|
| PubChem CID | 159817913 |
| Molecular Formula | C21H41OSi- |
| Molecular Weight | 337.64 g/mol |
| Exact Mass | 337.29 |
| IUPAC Name | [(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methoxy-tert-butyl-dimethylsilanuide |
| SMILES | C=C1CC[C@H]2C(C)(C)CCC[C@]2(C)[C@H]1CO[SiH-](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H41OSi/c1-16-11-12-18-20(5,6)13-10-14-21(18,7)17(16)15-22-23(8,9)19(2,3)4/h17-18,23H,1,10-15H2,2-9H3/q-1/t17-,18-,21+/m0/s1 |
| InChIKey | SEHUZIXSHCVHCU-BBTUJRGHSA-N |
| XLogP | 6.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.64 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|