C32H46OSi — CID 10917740
2-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethoxy-tert-butyl-diphenylsilane (PubChem CID 10917740) has the molecular formula C32H46OSi and a molecular weight of 474.81 g/mol. Its IUPAC name is 2-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethoxy-tert-butyl-diphenylsilane.
| Compound Name | 2-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 10917740 |
| Molecular Formula | C32H46OSi |
| Molecular Weight | 474.81 g/mol |
| Exact Mass | 474.33 |
| IUPAC Name | 2-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethoxy-tert-butyl-diphenylsilane |
| SMILES | C=C1CC[C@H]2C(C)(C)CCC[C@]2(C)[C@H]1CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H46OSi/c1-25-19-20-29-31(5,6)22-14-23-32(29,7)28(25)21-24-33-34(30(2,3)4,26-15-10-8-11-16-26)27-17-12-9-13-18-27/h8-13,15-18,28-29H,1,14,19-24H2,2-7H3/t28-,29-,32+/m0/s1 |
| InChIKey | HMRZOUUMABKFFR-LYVYPOQBSA-N |
| XLogP | 7.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.81 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|