C36H52O4Si — CID 100994441
(3S)-1-[(1R,3R,4aS,8aS)-3-hydroxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-3-methylpentan-1-one (PubChem CID 100994441) has the molecular formula C36H52O4Si and a molecular weight of 576.89 g/mol. Its IUPAC name is (3S)-1-[(1R,3R,4aS,8aS)-3-hydroxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-3-methylpentan-1-one.
| Compound Name | (3S)-1-[(1R,3R,4aS,8aS)-3-hydroxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-3-methylpentan-1-one |
|---|---|
| PubChem CID | 100994441 |
| Molecular Formula | C36H52O4Si |
| Molecular Weight | 576.89 g/mol |
| Exact Mass | 576.36 |
| IUPAC Name | (3S)-1-[(1R,3R,4aS,8aS)-3-hydroxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-3-methylpentan-1-one |
| SMILES | C=C1[C@H](C(=O)C[C@@](C)(O)CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@]2(C)CCCC(C)(C)[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C36H52O4Si/c1-26-29(37)24-31-34(5,6)20-15-21-36(31,8)32(26)30(38)25-35(7,39)22-23-40-41(33(2,3)4,27-16-11-9-12-17-27)28-18-13-10-14-19-28/h9-14,16-19,29,31-32,37,39H,1,15,20-25H2,2-8H3/t29-,31+,32-,35+,36+/m1/s1 |
| InChIKey | HFKGRAAXBXXNNP-MHZBBPKCSA-N |
| XLogP | 6.43 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.89 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|