C33H50O4SSi — CID 11766960
[(2S,3S,4S,4aR,8aS)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3,4a,8,8-tetramethyl-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl] methanesulfonate (PubChem CID 11766960) has the molecular formula C33H50O4SSi and a molecular weight of 570.91 g/mol. Its IUPAC name is [(2S,3S,4S,4aR,8aS)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3,4a,8,8-tetramethyl-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl] methanesulfonate.
| Compound Name | [(2S,3S,4S,4aR,8aS)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3,4a,8,8-tetramethyl-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 11766960 |
| Molecular Formula | C33H50O4SSi |
| Molecular Weight | 570.91 g/mol |
| Exact Mass | 570.32 |
| IUPAC Name | [(2S,3S,4S,4aR,8aS)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3,4a,8,8-tetramethyl-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl] methanesulfonate |
| SMILES | CC1[C@@H](OS(C)(=O)=O)C[C@H]2C(C)(C)CCC[C@]2(C)[C@H]1CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H50O4SSi/c1-25-28(33(7)22-15-21-32(5,6)30(33)24-29(25)37-38(8,34)35)20-23-36-39(31(2,3)4,26-16-11-9-12-17-26)27-18-13-10-14-19-27/h9-14,16-19,25,28-30H,15,20-24H2,1-8H3/t25?,28-,29-,30-,33+/m0/s1 |
| InChIKey | UHIIHKCXQIQXQU-MJLIIOATSA-N |
| XLogP | 6.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.91 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|