C41H60O2Si — CID 11050349
tert-butyl-[(Z)-3-methyl-5-[(1S,2R,7R,10S,11R,12S,14R)-2,6,6,10,12-pentamethyl-13-oxatetracyclo[8.5.0.02,7.012,14]pentadecan-11-yl]pent-2-enoxy]-diphenylsilane (PubChem CID 11050349) has the molecular formula C41H60O2Si and a molecular weight of 613.02 g/mol. Its IUPAC name is tert-butyl-[(Z)-3-methyl-5-[(1S,2R,7R,10S,11R,12S,14R)-2,6,6,10,12-pentamethyl-13-oxatetracyclo[8.5.0.02,7.012,14]pentadecan-11-yl]pent-2-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(Z)-3-methyl-5-[(1S,2R,7R,10S,11R,12S,14R)-2,6,6,10,12-pentamethyl-13-oxatetracyclo[8.5.0.02,7.012,14]pentadecan-11-yl]pent-2-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11050349 |
| Molecular Formula | C41H60O2Si |
| Molecular Weight | 613.02 g/mol |
| Exact Mass | 612.44 |
| IUPAC Name | tert-butyl-[(Z)-3-methyl-5-[(1S,2R,7R,10S,11R,12S,14R)-2,6,6,10,12-pentamethyl-13-oxatetracyclo[8.5.0.02,7.012,14]pentadecan-11-yl]pent-2-enoxy]-diphenylsilane |
| SMILES | C/C(=C/CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CC[C@@H]1[C@@]2(C)CC[C@@H]3C(C)(C)CCC[C@@]3(C)[C@@H]2C[C@H]2O[C@@]12C |
| InChI | InChI=1S/C41H60O2Si/c1-30(24-28-42-44(37(2,3)4,31-17-12-10-13-18-31)32-19-14-11-15-20-32)21-22-34-40(8)27-23-33-38(5,6)25-16-26-39(33,7)35(40)29-36-41(34,9)43-36/h10-15,17-20,24,33-36H,16,21-23,25-29H2,1-9H3/b30-24-/t33-,34-,35+,36-,39-,40-,41+/m1/s1 |
| InChIKey | PWBLJCJIMKZTEP-FXIORMIGSA-N |
| XLogP | 9.72 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.02 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|