C33H50O6Si — CID 11342122
(E,3S,4R)-9-[tert-butyl(diphenyl)silyl]oxy-1-[(2R,3R)-3-(hydroxymethyl)-3-methyloxiran-2-yl]-3-(methoxymethoxy)-3,7-dimethylnon-7-en-4-ol (PubChem CID 11342122) has the molecular formula C33H50O6Si and a molecular weight of 570.84 g/mol. Its IUPAC name is (E,3S,4R)-9-[tert-butyl(diphenyl)silyl]oxy-1-[(2R,3R)-3-(hydroxymethyl)-3-methyloxiran-2-yl]-3-(methoxymethoxy)-3,7-dimethylnon-7-en-4-ol.
| Compound Name | (E,3S,4R)-9-[tert-butyl(diphenyl)silyl]oxy-1-[(2R,3R)-3-(hydroxymethyl)-3-methyloxiran-2-yl]-3-(methoxymethoxy)-3,7-dimethylnon-7-en-4-ol |
|---|---|
| PubChem CID | 11342122 |
| Molecular Formula | C33H50O6Si |
| Molecular Weight | 570.84 g/mol |
| Exact Mass | 570.34 |
| IUPAC Name | (E,3S,4R)-9-[tert-butyl(diphenyl)silyl]oxy-1-[(2R,3R)-3-(hydroxymethyl)-3-methyloxiran-2-yl]-3-(methoxymethoxy)-3,7-dimethylnon-7-en-4-ol |
| SMILES | COCO[C@@](C)(CC[C@H]1O[C@]1(C)CO)[C@H](O)CC/C(C)=C/CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H50O6Si/c1-26(18-19-29(35)32(5,37-25-36-7)22-20-30-33(6,24-34)39-30)21-23-38-40(31(2,3)4,27-14-10-8-11-15-27)28-16-12-9-13-17-28/h8-17,21,29-30,34-35H,18-20,22-25H2,1-7H3/b26-21+/t29-,30-,32+,33-/m1/s1 |
| InChIKey | GVOJZPJSLKJURU-AYTGVWFXSA-N |
| XLogP | 4.96 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.84 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|