C21H29NO2Si — CID 24808385
O-[(E)-4-[tert-butyl(diphenyl)silyl]oxy-3-methylbut-2-enyl]hydroxylamine (PubChem CID 24808385) has the molecular formula C21H29NO2Si and a molecular weight of 355.55 g/mol. Its IUPAC name is O-[(E)-4-[tert-butyl(diphenyl)silyl]oxy-3-methylbut-2-enyl]hydroxylamine.
| Compound Name | O-[(E)-4-[tert-butyl(diphenyl)silyl]oxy-3-methylbut-2-enyl]hydroxylamine |
|---|---|
| PubChem CID | 24808385 |
| Molecular Formula | C21H29NO2Si |
| Molecular Weight | 355.55 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | O-[(E)-4-[tert-butyl(diphenyl)silyl]oxy-3-methylbut-2-enyl]hydroxylamine |
| SMILES | C/C(=C\CON)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C21H29NO2Si/c1-18(15-16-23-22)17-24-25(21(2,3)4,19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-15H,16-17,22H2,1-4H3/b18-15+ |
| InChIKey | MYQMXMJSNJHAJN-OBGWFSINSA-N |
| XLogP | 3.40 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.55 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|