C26H35ClOSi — CID 72997103
tert-butyl-(8-chloro-3,7-dimethylocta-2,6-dienoxy)-diphenylsilane (PubChem CID 72997103) has the molecular formula C26H35ClOSi and a molecular weight of 427.10 g/mol. Its IUPAC name is tert-butyl-(8-chloro-3,7-dimethylocta-2,6-dienoxy)-diphenylsilane.
| Compound Name | tert-butyl-(8-chloro-3,7-dimethylocta-2,6-dienoxy)-diphenylsilane |
|---|---|
| PubChem CID | 72997103 |
| Molecular Formula | C26H35ClOSi |
| Molecular Weight | 427.10 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | tert-butyl-(8-chloro-3,7-dimethylocta-2,6-dienoxy)-diphenylsilane |
| SMILES | CC(=CCCC(C)=CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CCl |
| InChI | InChI=1S/C26H35ClOSi/c1-22(13-12-14-23(2)21-27)19-20-28-29(26(3,4)5,24-15-8-6-9-16-24)25-17-10-7-11-18-25/h6-11,14-19H,12-13,20-21H2,1-5H3 |
| InChIKey | UBCFCSZPALFNNG-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.10 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|