C33H48OSi — CID 10624878
tert-butyl-[(2E,6E,10Z)-3-ethyl-7,11-dimethyltrideca-2,6,10-trienoxy]-diphenylsilane (PubChem CID 10624878) has the molecular formula C33H48OSi and a molecular weight of 488.83 g/mol. Its IUPAC name is tert-butyl-[(2E,6E,10Z)-3-ethyl-7,11-dimethyltrideca-2,6,10-trienoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2E,6E,10Z)-3-ethyl-7,11-dimethyltrideca-2,6,10-trienoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10624878 |
| Molecular Formula | C33H48OSi |
| Molecular Weight | 488.83 g/mol |
| Exact Mass | 488.35 |
| IUPAC Name | tert-butyl-[(2E,6E,10Z)-3-ethyl-7,11-dimethyltrideca-2,6,10-trienoxy]-diphenylsilane |
| SMILES | CC/C(C)=C\CC/C(C)=C/CC/C(=C/CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CC |
| InChI | InChI=1S/C33H48OSi/c1-8-28(3)18-16-19-29(4)20-17-21-30(9-2)26-27-34-35(33(5,6)7,31-22-12-10-13-23-31)32-24-14-11-15-25-32/h10-15,18,20,22-26H,8-9,16-17,19,21,27H2,1-7H3/b28-18-,29-20+,30-26+ |
| InChIKey | OSBXJHIKGWTFFO-HJJUHVBWSA-N |
| XLogP | 8.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.83 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|