C28H40O4SSi — CID 10553464
[(2E,6E)-8-[tert-butyl(diphenyl)silyl]oxy-2-ethyl-6-methylocta-2,6-dienyl] methanesulfonate (PubChem CID 10553464) has the molecular formula C28H40O4SSi and a molecular weight of 500.78 g/mol. Its IUPAC name is [(2E,6E)-8-[tert-butyl(diphenyl)silyl]oxy-2-ethyl-6-methylocta-2,6-dienyl] methanesulfonate.
| Compound Name | [(2E,6E)-8-[tert-butyl(diphenyl)silyl]oxy-2-ethyl-6-methylocta-2,6-dienyl] methanesulfonate |
|---|---|
| PubChem CID | 10553464 |
| Molecular Formula | C28H40O4SSi |
| Molecular Weight | 500.78 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | [(2E,6E)-8-[tert-butyl(diphenyl)silyl]oxy-2-ethyl-6-methylocta-2,6-dienyl] methanesulfonate |
| SMILES | CC/C(=C\CC/C(C)=C/CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)COS(C)(=O)=O |
| InChI | InChI=1S/C28H40O4SSi/c1-7-25(23-31-33(6,29)30)16-14-15-24(2)21-22-32-34(28(3,4)5,26-17-10-8-11-18-26)27-19-12-9-13-20-27/h8-13,16-21H,7,14-15,22-23H2,1-6H3/b24-21+,25-16+ |
| InChIKey | VBXRJKRUZZLAJJ-UWHCKCMLSA-N |
| XLogP | 5.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.78 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|