C31H44O3Si — CID 10767465
[(2E,6E,8R)-10-[tert-butyl(diphenyl)silyl]oxy-3,7,8-trimethyldeca-2,6-dienyl] acetate (PubChem CID 10767465) has the molecular formula C31H44O3Si and a molecular weight of 492.78 g/mol. Its IUPAC name is [(2E,6E,8R)-10-[tert-butyl(diphenyl)silyl]oxy-3,7,8-trimethyldeca-2,6-dienyl] acetate.
| Compound Name | [(2E,6E,8R)-10-[tert-butyl(diphenyl)silyl]oxy-3,7,8-trimethyldeca-2,6-dienyl] acetate |
|---|---|
| PubChem CID | 10767465 |
| Molecular Formula | C31H44O3Si |
| Molecular Weight | 492.78 g/mol |
| Exact Mass | 492.31 |
| IUPAC Name | [(2E,6E,8R)-10-[tert-butyl(diphenyl)silyl]oxy-3,7,8-trimethyldeca-2,6-dienyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)CC/C=C(\C)[C@H](C)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H44O3Si/c1-25(21-23-33-28(4)32)15-14-16-26(2)27(3)22-24-34-35(31(5,6)7,29-17-10-8-11-18-29)30-19-12-9-13-20-30/h8-13,16-21,27H,14-15,22-24H2,1-7H3/b25-21+,26-16+/t27-/m1/s1 |
| InChIKey | MGPKXBSGOCVGIU-RPBJFFLVSA-N |
| XLogP | 6.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.78 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|