C25H34O5Si — CID 102309338
[(E,5S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-5,6-dihydroxyhept-2-enyl] acetate (PubChem CID 102309338) has the molecular formula C25H34O5Si and a molecular weight of 442.63 g/mol. Its IUPAC name is [(E,5S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-5,6-dihydroxyhept-2-enyl] acetate.
| Compound Name | [(E,5S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-5,6-dihydroxyhept-2-enyl] acetate |
|---|---|
| PubChem CID | 102309338 |
| Molecular Formula | C25H34O5Si |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | [(E,5S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-5,6-dihydroxyhept-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C/C[C@H](O)[C@@H](O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H34O5Si/c1-20(26)29-18-12-11-17-23(27)24(28)19-30-31(25(2,3)4,21-13-7-5-8-14-21)22-15-9-6-10-16-22/h5-16,23-24,27-28H,17-19H2,1-4H3/b12-11+/t23-,24-/m0/s1 |
| InChIKey | OWOSDOUVGKLIAF-CFHGVRTOSA-N |
| XLogP | 2.79 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|