C26H35NO3Si — CID 11048409
[(2R,4R)-5-[tert-butyl(diphenyl)silyl]oxy-2-(cyanomethyl)-4-methylpentyl] acetate (PubChem CID 11048409) has the molecular formula C26H35NO3Si and a molecular weight of 437.66 g/mol. Its IUPAC name is [(2R,4R)-5-[tert-butyl(diphenyl)silyl]oxy-2-(cyanomethyl)-4-methylpentyl] acetate.
| Compound Name | [(2R,4R)-5-[tert-butyl(diphenyl)silyl]oxy-2-(cyanomethyl)-4-methylpentyl] acetate |
|---|---|
| PubChem CID | 11048409 |
| Molecular Formula | C26H35NO3Si |
| Molecular Weight | 437.66 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | [(2R,4R)-5-[tert-butyl(diphenyl)silyl]oxy-2-(cyanomethyl)-4-methylpentyl] acetate |
| SMILES | CC(=O)OC[C@@H](CC#N)C[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H35NO3Si/c1-21(18-23(16-17-27)20-29-22(2)28)19-30-31(26(3,4)5,24-12-8-6-9-13-24)25-14-10-7-11-15-25/h6-15,21,23H,16,18-20H2,1-5H3/t21-,23+/m1/s1 |
| InChIKey | QIFWNRNMHKYBBR-GGAORHGYSA-N |
| XLogP | 4.68 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.66 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|