C27H40O3Si — CID 102512037
methyl (2S,4R,6R)-7-[tert-butyl(diphenyl)silyl]oxy-2,4,6-trimethylheptanoate (PubChem CID 102512037) has the molecular formula C27H40O3Si and a molecular weight of 440.70 g/mol. Its IUPAC name is methyl (2S,4R,6R)-7-[tert-butyl(diphenyl)silyl]oxy-2,4,6-trimethylheptanoate.
| Compound Name | methyl (2S,4R,6R)-7-[tert-butyl(diphenyl)silyl]oxy-2,4,6-trimethylheptanoate |
|---|---|
| PubChem CID | 102512037 |
| Molecular Formula | C27H40O3Si |
| Molecular Weight | 440.70 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | methyl (2S,4R,6R)-7-[tert-butyl(diphenyl)silyl]oxy-2,4,6-trimethylheptanoate |
| SMILES | COC(=O)[C@@H](C)C[C@H](C)C[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H40O3Si/c1-21(19-23(3)26(28)29-7)18-22(2)20-30-31(27(4,5)6,24-14-10-8-11-15-24)25-16-12-9-13-17-25/h8-17,21-23H,18-20H2,1-7H3/t21-,22-,23+/m1/s1 |
| InChIKey | GLVBLGDGRGOUIL-ZLNRFVROSA-N |
| XLogP | 5.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.70 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|