C26H38O3Si — CID 10788581
(3S,4S,5R,6R)-1-[tert-butyl(diphenyl)silyl]oxy-4,6-dimethyloct-7-ene-3,5-diol (PubChem CID 10788581) has the molecular formula C26H38O3Si and a molecular weight of 426.67 g/mol. Its IUPAC name is (3S,4S,5R,6R)-1-[tert-butyl(diphenyl)silyl]oxy-4,6-dimethyloct-7-ene-3,5-diol.
| Compound Name | (3S,4S,5R,6R)-1-[tert-butyl(diphenyl)silyl]oxy-4,6-dimethyloct-7-ene-3,5-diol |
|---|---|
| PubChem CID | 10788581 |
| Molecular Formula | C26H38O3Si |
| Molecular Weight | 426.67 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | (3S,4S,5R,6R)-1-[tert-butyl(diphenyl)silyl]oxy-4,6-dimethyloct-7-ene-3,5-diol |
| SMILES | C=C[C@@H](C)[C@@H](O)[C@@H](C)[C@@H](O)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H38O3Si/c1-7-20(2)25(28)21(3)24(27)18-19-29-30(26(4,5)6,22-14-10-8-11-15-22)23-16-12-9-13-17-23/h7-17,20-21,24-25,27-28H,1,18-19H2,2-6H3/t20-,21+,24+,25-/m1/s1 |
| InChIKey | KUMFQTUXHNEWJF-HWIPXOPOSA-N |
| XLogP | 4.13 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.67 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|