C23H34O4Si — CID 162397807
(2S,3R,4S)-6-[tert-butyl(diphenyl)silyl]oxy-3-methylhexane-1,2,4-triol (PubChem CID 162397807) has the molecular formula C23H34O4Si and a molecular weight of 402.61 g/mol. Its IUPAC name is (2S,3R,4S)-6-[tert-butyl(diphenyl)silyl]oxy-3-methylhexane-1,2,4-triol.
| Compound Name | (2S,3R,4S)-6-[tert-butyl(diphenyl)silyl]oxy-3-methylhexane-1,2,4-triol |
|---|---|
| PubChem CID | 162397807 |
| Molecular Formula | C23H34O4Si |
| Molecular Weight | 402.61 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | (2S,3R,4S)-6-[tert-butyl(diphenyl)silyl]oxy-3-methylhexane-1,2,4-triol |
| SMILES | C[C@@H]([C@H](O)CO)[C@@H](O)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H34O4Si/c1-18(22(26)17-24)21(25)15-16-27-28(23(2,3)4,19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-14,18,21-22,24-26H,15-17H2,1-4H3/t18-,21+,22-/m1/s1 |
| InChIKey | OHVWXQFQGVBJCC-BVYCBKJFSA-N |
| XLogP | 2.30 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.61 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|