C42H56OSi — CID 140737174
tert-butyl-diphenyl-[(2Z,6Z,10Z)-3,7,11,15-tetramethyl-9-phenylhexadeca-2,6,10,14-tetraenoxy]silane (PubChem CID 140737174) has the molecular formula C42H56OSi and a molecular weight of 605.00 g/mol. Its IUPAC name is tert-butyl-diphenyl-[(2Z,6Z,10Z)-3,7,11,15-tetramethyl-9-phenylhexadeca-2,6,10,14-tetraenoxy]silane.
| Compound Name | tert-butyl-diphenyl-[(2Z,6Z,10Z)-3,7,11,15-tetramethyl-9-phenylhexadeca-2,6,10,14-tetraenoxy]silane |
|---|---|
| PubChem CID | 140737174 |
| Molecular Formula | C42H56OSi |
| Molecular Weight | 605.00 g/mol |
| Exact Mass | 604.41 |
| IUPAC Name | tert-butyl-diphenyl-[(2Z,6Z,10Z)-3,7,11,15-tetramethyl-9-phenylhexadeca-2,6,10,14-tetraenoxy]silane |
| SMILES | CC(C)=CCC/C(C)=C\C(C/C(C)=C\CC/C(C)=C\CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C42H56OSi/c1-34(2)20-18-22-36(4)32-39(38-24-12-9-13-25-38)33-37(5)23-19-21-35(3)30-31-43-44(42(6,7)8,40-26-14-10-15-27-40)41-28-16-11-17-29-41/h9-17,20,23-30,32,39H,18-19,21-22,31,33H2,1-8H3/b35-30-,36-32-,37-23- |
| InChIKey | BGRKRISDVVLOFR-MUSOAXGKSA-N |
| XLogP | 11.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.00 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|