C22H29FOSi — CID 163904820
tert-butyl-[3-(fluoromethylidene)pentoxy]-diphenylsilane (PubChem CID 163904820) has the molecular formula C22H29FOSi and a molecular weight of 356.56 g/mol. Its IUPAC name is tert-butyl-[3-(fluoromethylidene)pentoxy]-diphenylsilane.
| Compound Name | tert-butyl-[3-(fluoromethylidene)pentoxy]-diphenylsilane |
|---|---|
| PubChem CID | 163904820 |
| Molecular Formula | C22H29FOSi |
| Molecular Weight | 356.56 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | tert-butyl-[3-(fluoromethylidene)pentoxy]-diphenylsilane |
| SMILES | CCC(=CF)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C22H29FOSi/c1-5-19(18-23)16-17-24-25(22(2,3)4,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-15,18H,5,16-17H2,1-4H3 |
| InChIKey | ZIPOQIUMHGEFOQ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.56 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|