C26H40O3Si2 — CID 67767772
1-[tert-butyl(dimethyl)silyl]oxy-4-[tert-butyl(diphenyl)silyl]oxybut-1-en-2-ol (PubChem CID 67767772) has the molecular formula C26H40O3Si2 and a molecular weight of 456.78 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]oxy-4-[tert-butyl(diphenyl)silyl]oxybut-1-en-2-ol.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]oxy-4-[tert-butyl(diphenyl)silyl]oxybut-1-en-2-ol |
|---|---|
| PubChem CID | 67767772 |
| Molecular Formula | C26H40O3Si2 |
| Molecular Weight | 456.78 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]oxy-4-[tert-butyl(diphenyl)silyl]oxybut-1-en-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC=C(O)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H40O3Si2/c1-25(2,3)30(7,8)29-21-22(27)19-20-28-31(26(4,5)6,23-15-11-9-12-16-23)24-17-13-10-14-18-24/h9-18,21,27H,19-20H2,1-8H3 |
| InChIKey | ZLYLHETVWMPGBL-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.78 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|