C39H64O5Si2 — CID 11273873
(2E,6S,7R,10E)-12-[tert-butyl(diphenyl)silyl]oxy-6-(methoxymethoxy)-2,6,10-trimethyl-7-triethylsilyloxydodeca-2,10-dien-1-ol (PubChem CID 11273873) has the molecular formula C39H64O5Si2 and a molecular weight of 669.11 g/mol. Its IUPAC name is (2E,6S,7R,10E)-12-[tert-butyl(diphenyl)silyl]oxy-6-(methoxymethoxy)-2,6,10-trimethyl-7-triethylsilyloxydodeca-2,10-dien-1-ol.
| Compound Name | (2E,6S,7R,10E)-12-[tert-butyl(diphenyl)silyl]oxy-6-(methoxymethoxy)-2,6,10-trimethyl-7-triethylsilyloxydodeca-2,10-dien-1-ol |
|---|---|
| PubChem CID | 11273873 |
| Molecular Formula | C39H64O5Si2 |
| Molecular Weight | 669.11 g/mol |
| Exact Mass | 668.43 |
| IUPAC Name | (2E,6S,7R,10E)-12-[tert-butyl(diphenyl)silyl]oxy-6-(methoxymethoxy)-2,6,10-trimethyl-7-triethylsilyloxydodeca-2,10-dien-1-ol |
| SMILES | CC[Si](CC)(CC)O[C@H](CC/C(C)=C/CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@](C)(CC/C=C(\C)CO)OCOC |
| InChI | InChI=1S/C39H64O5Si2/c1-11-45(12-2,13-3)44-37(39(9,42-32-41-10)29-20-21-34(5)31-40)27-26-33(4)28-30-43-46(38(6,7)8,35-22-16-14-17-23-35)36-24-18-15-19-25-36/h14-19,21-25,28,37,40H,11-13,20,26-27,29-32H2,1-10H3/b33-28+,34-21+/t37-,39+/m1/s1 |
| InChIKey | VJABYXYPALVMBK-MLIQFIKOSA-N |
| XLogP | 8.78 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.11 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|