C33H42O5Si — CID 10768955
[(E,2R,3S)-8-[tert-butyl(diphenyl)silyl]oxy-1,2-dihydroxy-2,6-dimethyloct-6-en-3-yl] benzoate (PubChem CID 10768955) has the molecular formula C33H42O5Si and a molecular weight of 546.78 g/mol. Its IUPAC name is [(E,2R,3S)-8-[tert-butyl(diphenyl)silyl]oxy-1,2-dihydroxy-2,6-dimethyloct-6-en-3-yl] benzoate.
| Compound Name | [(E,2R,3S)-8-[tert-butyl(diphenyl)silyl]oxy-1,2-dihydroxy-2,6-dimethyloct-6-en-3-yl] benzoate |
|---|---|
| PubChem CID | 10768955 |
| Molecular Formula | C33H42O5Si |
| Molecular Weight | 546.78 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | [(E,2R,3S)-8-[tert-butyl(diphenyl)silyl]oxy-1,2-dihydroxy-2,6-dimethyloct-6-en-3-yl] benzoate |
| SMILES | C/C(=C\CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CC[C@H](OC(=O)c1ccccc1)[C@](C)(O)CO |
| InChI | InChI=1S/C33H42O5Si/c1-26(21-22-30(33(5,36)25-34)38-31(35)27-15-9-6-10-16-27)23-24-37-39(32(2,3)4,28-17-11-7-12-18-28)29-19-13-8-14-20-29/h6-20,23,30,34,36H,21-22,24-25H2,1-5H3/b26-23+/t30-,33+/m0/s1 |
| InChIKey | LMFCPBVKOQNAOJ-GRJGVMCHSA-N |
| XLogP | 5.26 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.78 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|