C30H34FNO5Si — CID 172792551
[(Z,4R)-6-[tert-butyl(diphenyl)silyl]oxy-4-carbamoyloxy-3-fluorohex-2-enyl] benzoate (PubChem CID 172792551) has the molecular formula C30H34FNO5Si and a molecular weight of 535.69 g/mol. Its IUPAC name is [(Z,4R)-6-[tert-butyl(diphenyl)silyl]oxy-4-carbamoyloxy-3-fluorohex-2-enyl] benzoate.
| Compound Name | [(Z,4R)-6-[tert-butyl(diphenyl)silyl]oxy-4-carbamoyloxy-3-fluorohex-2-enyl] benzoate |
|---|---|
| PubChem CID | 172792551 |
| Molecular Formula | C30H34FNO5Si |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | [(Z,4R)-6-[tert-butyl(diphenyl)silyl]oxy-4-carbamoyloxy-3-fluorohex-2-enyl] benzoate |
| SMILES | CC(C)(C)[Si](OCC[C@@H](OC(N)=O)/C(F)=C/COC(=O)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H34FNO5Si/c1-30(2,3)38(24-15-9-5-10-16-24,25-17-11-6-12-18-25)36-22-20-27(37-29(32)34)26(31)19-21-35-28(33)23-13-7-4-8-14-23/h4-19,27H,20-22H2,1-3H3,(H2,32,34)/b26-19-/t27-/m1/s1 |
| InChIKey | PTOFJYVIKFSEDB-MIKFSWKUSA-N |
| XLogP | 5.13 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|