C23H29F2NO3Si — CID 172719132
[(3R)-1-[tert-butyl(diphenyl)silyl]oxy-4,4-difluorohex-5-en-3-yl] carbamate (PubChem CID 172719132) has the molecular formula C23H29F2NO3Si and a molecular weight of 433.57 g/mol. Its IUPAC name is [(3R)-1-[tert-butyl(diphenyl)silyl]oxy-4,4-difluorohex-5-en-3-yl] carbamate.
| Compound Name | [(3R)-1-[tert-butyl(diphenyl)silyl]oxy-4,4-difluorohex-5-en-3-yl] carbamate |
|---|---|
| PubChem CID | 172719132 |
| Molecular Formula | C23H29F2NO3Si |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | [(3R)-1-[tert-butyl(diphenyl)silyl]oxy-4,4-difluorohex-5-en-3-yl] carbamate |
| SMILES | C=CC(F)(F)[C@@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC(N)=O |
| InChI | InChI=1S/C23H29F2NO3Si/c1-5-23(24,25)20(29-21(26)27)16-17-28-30(22(2,3)4,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h5-15,20H,1,16-17H2,2-4H3,(H2,26,27)/t20-/m1/s1 |
| InChIKey | GGODNSCRGUVNAW-HXUWFJFHSA-N |
| XLogP | 4.24 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|