C30H42O3Si — CID 10648349
(6R,7R)-9-[tert-butyl(diphenyl)silyl]oxy-6-ethenyl-2,2,7-trimethyl-4-oxononanal (PubChem CID 10648349) has the molecular formula C30H42O3Si and a molecular weight of 478.75 g/mol. Its IUPAC name is (6R,7R)-9-[tert-butyl(diphenyl)silyl]oxy-6-ethenyl-2,2,7-trimethyl-4-oxononanal.
| Compound Name | (6R,7R)-9-[tert-butyl(diphenyl)silyl]oxy-6-ethenyl-2,2,7-trimethyl-4-oxononanal |
|---|---|
| PubChem CID | 10648349 |
| Molecular Formula | C30H42O3Si |
| Molecular Weight | 478.75 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | (6R,7R)-9-[tert-butyl(diphenyl)silyl]oxy-6-ethenyl-2,2,7-trimethyl-4-oxononanal |
| SMILES | C=C[C@@H](CC(=O)CC(C)(C)C=O)[C@H](C)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H42O3Si/c1-8-25(21-26(32)22-30(6,7)23-31)24(2)19-20-33-34(29(3,4)5,27-15-11-9-12-16-27)28-17-13-10-14-18-28/h8-18,23-25H,1,19-22H2,2-7H3/t24-,25+/m1/s1 |
| InChIKey | YWVGXJUVGIRJLS-RPBOFIJWSA-N |
| XLogP | 5.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.75 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|