C34H55NO3Si2 — CID 11273241
(2R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N,N-diethylpent-4-enamide (PubChem CID 11273241) has the molecular formula C34H55NO3Si2 and a molecular weight of 581.99 g/mol. Its IUPAC name is (2R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N,N-diethylpent-4-enamide.
| Compound Name | (2R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N,N-diethylpent-4-enamide |
|---|---|
| PubChem CID | 11273241 |
| Molecular Formula | C34H55NO3Si2 |
| Molecular Weight | 581.99 g/mol |
| Exact Mass | 581.37 |
| IUPAC Name | (2R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N,N-diethylpent-4-enamide |
| SMILES | C=C[C@@H](CO[Si](C)(C)C(C)(C)C)[C@@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)N(CC)CC |
| InChI | InChI=1S/C34H55NO3Si2/c1-12-28(27-38-39(10,11)33(4,5)6)31(32(36)35(13-2)14-3)25-26-37-40(34(7,8)9,29-21-17-15-18-22-29)30-23-19-16-20-24-30/h12,15-24,28,31H,1,13-14,25-27H2,2-11H3/t28-,31+/m0/s1 |
| InChIKey | MUFNVUIOCSGABT-QCENPCRXSA-N |
| XLogP | 7.26 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.99 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|