C36H56O5Si2 — CID 11017592
methyl (2S,3R,4E,6E)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-9-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-8,8-dimethylnona-4,6-dienoate (PubChem CID 11017592) has the molecular formula C36H56O5Si2 and a molecular weight of 625.01 g/mol. Its IUPAC name is methyl (2S,3R,4E,6E)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-9-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-8,8-dimethylnona-4,6-dienoate.
| Compound Name | methyl (2S,3R,4E,6E)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-9-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-8,8-dimethylnona-4,6-dienoate |
|---|---|
| PubChem CID | 11017592 |
| Molecular Formula | C36H56O5Si2 |
| Molecular Weight | 625.01 g/mol |
| Exact Mass | 624.37 |
| IUPAC Name | methyl (2S,3R,4E,6E)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-9-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-8,8-dimethylnona-4,6-dienoate |
| SMILES | COC(=O)[C@@H](CCO[Si](C)(C)C(C)(C)C)[C@H](O)/C=C/C=C/C(C)(C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C36H56O5Si2/c1-34(2,3)42(10,11)40-27-25-31(33(38)39-9)32(37)24-18-19-26-36(7,8)28-41-43(35(4,5)6,29-20-14-12-15-21-29)30-22-16-13-17-23-30/h12-24,26,31-32,37H,25,27-28H2,1-11H3/b24-18+,26-19+/t31-,32+/m0/s1 |
| InChIKey | MQGXAIJVYUKOAP-CWFPFQHDSA-N |
| XLogP | 7.26 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.01 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|