C27H36O5Si — CID 135072238
dimethyl 2-[1-[tert-butyl(diphenyl)silyl]oxyhex-5-en-2-yl]propanedioate (PubChem CID 135072238) has the molecular formula C27H36O5Si and a molecular weight of 468.67 g/mol. Its IUPAC name is dimethyl 2-[1-[tert-butyl(diphenyl)silyl]oxyhex-5-en-2-yl]propanedioate.
| Compound Name | dimethyl 2-[1-[tert-butyl(diphenyl)silyl]oxyhex-5-en-2-yl]propanedioate |
|---|---|
| PubChem CID | 135072238 |
| Molecular Formula | C27H36O5Si |
| Molecular Weight | 468.67 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | dimethyl 2-[1-[tert-butyl(diphenyl)silyl]oxyhex-5-en-2-yl]propanedioate |
| SMILES | C=CCCC(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C27H36O5Si/c1-7-8-15-21(24(25(28)30-5)26(29)31-6)20-32-33(27(2,3)4,22-16-11-9-12-17-22)23-18-13-10-14-19-23/h7,9-14,16-19,21,24H,1,8,15,20H2,2-6H3 |
| InChIKey | OWVMCKZNFMFDMH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.67 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|