C27H38O4Si — CID 11396886
methyl (2R)-2-[(1R,2S)-3-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-2-methylpropyl]-2-methylpent-4-enoate (PubChem CID 11396886) has the molecular formula C27H38O4Si and a molecular weight of 454.68 g/mol. Its IUPAC name is methyl (2R)-2-[(1R,2S)-3-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-2-methylpropyl]-2-methylpent-4-enoate.
| Compound Name | methyl (2R)-2-[(1R,2S)-3-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-2-methylpropyl]-2-methylpent-4-enoate |
|---|---|
| PubChem CID | 11396886 |
| Molecular Formula | C27H38O4Si |
| Molecular Weight | 454.68 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | methyl (2R)-2-[(1R,2S)-3-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-2-methylpropyl]-2-methylpent-4-enoate |
| SMILES | C=CC[C@@](C)(C(=O)OC)[C@H](O)[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H38O4Si/c1-8-19-27(6,25(29)30-7)24(28)21(2)20-31-32(26(3,4)5,22-15-11-9-12-16-22)23-17-13-10-14-18-23/h8-18,21,24,28H,1,19-20H2,2-7H3/t21-,24+,27+/m0/s1 |
| InChIKey | NPFVWBKTLWMMJR-YEEURNOCSA-N |
| XLogP | 4.32 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.68 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|