C32H38O6Si — CID 101109049
dimethyl 2-benzyl-2-[(E,3S)-4-[tert-butyl(diphenyl)silyl]oxy-3-hydroxybut-1-enyl]propanedioate (PubChem CID 101109049) has the molecular formula C32H38O6Si and a molecular weight of 546.74 g/mol. Its IUPAC name is dimethyl 2-benzyl-2-[(E,3S)-4-[tert-butyl(diphenyl)silyl]oxy-3-hydroxybut-1-enyl]propanedioate.
| Compound Name | dimethyl 2-benzyl-2-[(E,3S)-4-[tert-butyl(diphenyl)silyl]oxy-3-hydroxybut-1-enyl]propanedioate |
|---|---|
| PubChem CID | 101109049 |
| Molecular Formula | C32H38O6Si |
| Molecular Weight | 546.74 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | dimethyl 2-benzyl-2-[(E,3S)-4-[tert-butyl(diphenyl)silyl]oxy-3-hydroxybut-1-enyl]propanedioate |
| SMILES | COC(=O)C(/C=C/[C@H](O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)(Cc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C32H38O6Si/c1-31(2,3)39(27-17-11-7-12-18-27,28-19-13-8-14-20-28)38-24-26(33)21-22-32(29(34)36-4,30(35)37-5)23-25-15-9-6-10-16-25/h6-22,26,33H,23-24H2,1-5H3/b22-21+/t26-/m0/s1 |
| InChIKey | MKVFFELTLXMZQP-RFJJORBGSA-N |
| XLogP | 4.06 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.74 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|