C27H33NO4Si — CID 169099958
benzyl N-[3-[tert-butyl(diphenyl)silyl]oxy-2-hydroxypropyl]carbamate (PubChem CID 169099958) has the molecular formula C27H33NO4Si and a molecular weight of 463.65 g/mol. Its IUPAC name is benzyl N-[3-[tert-butyl(diphenyl)silyl]oxy-2-hydroxypropyl]carbamate.
| Compound Name | benzyl N-[3-[tert-butyl(diphenyl)silyl]oxy-2-hydroxypropyl]carbamate |
|---|---|
| PubChem CID | 169099958 |
| Molecular Formula | C27H33NO4Si |
| Molecular Weight | 463.65 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | benzyl N-[3-[tert-butyl(diphenyl)silyl]oxy-2-hydroxypropyl]carbamate |
| SMILES | CC(C)(C)[Si](OCC(O)CNC(=O)OCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H33NO4Si/c1-27(2,3)33(24-15-9-5-10-16-24,25-17-11-6-12-18-25)32-21-23(29)19-28-26(30)31-20-22-13-7-4-8-14-22/h4-18,23,29H,19-21H2,1-3H3,(H,28,30) |
| InChIKey | WOIJQLOOSWSVDS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.65 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|