C37H44N2O6Si — CID 102230944
benzyl N-[(2S)-4-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-3-methylbutan-2-yl]-N-(phenylmethoxycarbonylamino)carbamate (PubChem CID 102230944) has the molecular formula C37H44N2O6Si and a molecular weight of 640.85 g/mol. Its IUPAC name is benzyl N-[(2S)-4-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-3-methylbutan-2-yl]-N-(phenylmethoxycarbonylamino)carbamate.
| Compound Name | benzyl N-[(2S)-4-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-3-methylbutan-2-yl]-N-(phenylmethoxycarbonylamino)carbamate |
|---|---|
| PubChem CID | 102230944 |
| Molecular Formula | C37H44N2O6Si |
| Molecular Weight | 640.85 g/mol |
| Exact Mass | 640.30 |
| IUPAC Name | benzyl N-[(2S)-4-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-3-methylbutan-2-yl]-N-(phenylmethoxycarbonylamino)carbamate |
| SMILES | CC(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](CO)N(NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C37H44N2O6Si/c1-29(26-45-46(37(2,3)4,32-21-13-7-14-22-32)33-23-15-8-16-24-33)34(25-40)39(36(42)44-28-31-19-11-6-12-20-31)38-35(41)43-27-30-17-9-5-10-18-30/h5-24,29,34,40H,25-28H2,1-4H3,(H,38,41)/t29?,34-/m1/s1 |
| InChIKey | HMMCZIWBZRLXDV-VWERDZHISA-N |
| XLogP | 6.04 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.85 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|