C34H54N2O6Si — CID 138977333
benzyl N-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxydodecan-2-yl]-N-(phenylmethoxycarbonylamino)carbamate (PubChem CID 138977333) has the molecular formula C34H54N2O6Si and a molecular weight of 614.90 g/mol. Its IUPAC name is benzyl N-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxydodecan-2-yl]-N-(phenylmethoxycarbonylamino)carbamate.
| Compound Name | benzyl N-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxydodecan-2-yl]-N-(phenylmethoxycarbonylamino)carbamate |
|---|---|
| PubChem CID | 138977333 |
| Molecular Formula | C34H54N2O6Si |
| Molecular Weight | 614.90 g/mol |
| Exact Mass | 614.38 |
| IUPAC Name | benzyl N-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxydodecan-2-yl]-N-(phenylmethoxycarbonylamino)carbamate |
| SMILES | CCCCCCCCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)N(NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H54N2O6Si/c1-7-8-9-10-11-12-19-24-31(42-43(5,6)34(2,3)4)30(25-37)36(33(39)41-27-29-22-17-14-18-23-29)35-32(38)40-26-28-20-15-13-16-21-28/h13-18,20-23,30-31,37H,7-12,19,24-27H2,1-6H3,(H,35,38)/t30-,31+/m1/s1 |
| InChIKey | LOOIQEVIBAJNEX-JSOSNVBQSA-N |
| XLogP | 8.36 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.90 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|