C33H48N2O7Si — CID 138981421
ethyl (E,4S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]non-2-enoate (PubChem CID 138981421) has the molecular formula C33H48N2O7Si and a molecular weight of 612.84 g/mol. Its IUPAC name is ethyl (E,4S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]non-2-enoate.
| Compound Name | ethyl (E,4S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]non-2-enoate |
|---|---|
| PubChem CID | 138981421 |
| Molecular Formula | C33H48N2O7Si |
| Molecular Weight | 612.84 g/mol |
| Exact Mass | 612.32 |
| IUPAC Name | ethyl (E,4S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]non-2-enoate |
| SMILES | CCC[C@H](C[C@@H](/C=C/C(=O)OCC)N(NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H48N2O7Si/c1-8-16-29(42-43(6,7)33(3,4)5)23-28(21-22-30(36)39-9-2)35(32(38)41-25-27-19-14-11-15-20-27)34-31(37)40-24-26-17-12-10-13-18-26/h10-15,17-22,28-29H,8-9,16,23-25H2,1-7H3,(H,34,37)/b22-21+/t28-,29-/m1/s1 |
| InChIKey | FRIBLFIGQCROAQ-PHJMZONKSA-N |
| XLogP | 7.54 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.84 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|