C27H38O5Si — CID 153399419
ethyl (E)-3-[2-[2-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxypropoxy]phenyl]prop-2-enoate (PubChem CID 153399419) has the molecular formula C27H38O5Si and a molecular weight of 470.68 g/mol. Its IUPAC name is ethyl (E)-3-[2-[2-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxypropoxy]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[2-[2-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxypropoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 153399419 |
| Molecular Formula | C27H38O5Si |
| Molecular Weight | 470.68 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | ethyl (E)-3-[2-[2-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxypropoxy]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccccc1OCC(COCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H38O5Si/c1-7-30-26(28)18-17-23-15-11-12-16-25(23)31-21-24(32-33(5,6)27(2,3)4)20-29-19-22-13-9-8-10-14-22/h8-18,24H,7,19-21H2,1-6H3/b18-17+ |
| InChIKey | GZUXXPIJHKKBPH-ISLYRVAYSA-N |
| XLogP | 6.25 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.68 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|