C19H28Cl2O3Si — CID 102343029
ethyl (E)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dichloro-5-phenylpent-2-enoate (PubChem CID 102343029) has the molecular formula C19H28Cl2O3Si and a molecular weight of 403.42 g/mol. Its IUPAC name is ethyl (E)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dichloro-5-phenylpent-2-enoate.
| Compound Name | ethyl (E)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dichloro-5-phenylpent-2-enoate |
|---|---|
| PubChem CID | 102343029 |
| Molecular Formula | C19H28Cl2O3Si |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | ethyl (E)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dichloro-5-phenylpent-2-enoate |
| SMILES | CCOC(=O)/C=C/C(Cl)(Cl)C(O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C19H28Cl2O3Si/c1-7-23-16(22)13-14-19(20,21)17(15-11-9-8-10-12-15)24-25(5,6)18(2,3)4/h8-14,17H,7H2,1-6H3/b14-13+ |
| InChIKey | KILUZMLEAHKCEW-BUHFOSPRSA-N |
| XLogP | 6.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|