C24H33NO3Si — CID 56838749
ethyl (E)-3-[2-[(S)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-6-methyl-4-pyridinyl]prop-2-enoate (PubChem CID 56838749) has the molecular formula C24H33NO3Si and a molecular weight of 411.62 g/mol. Its IUPAC name is ethyl (E)-3-[2-[(S)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-6-methyl-4-pyridinyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[2-[(S)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-6-methyl-4-pyridinyl]prop-2-enoate |
|---|---|
| PubChem CID | 56838749 |
| Molecular Formula | C24H33NO3Si |
| Molecular Weight | 411.62 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | ethyl (E)-3-[2-[(S)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-6-methyl-4-pyridinyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cc(C)nc([C@@H](O[Si](C)(C)C(C)(C)C)c2ccccc2)c1 |
| InChI | InChI=1S/C24H33NO3Si/c1-8-27-22(26)15-14-19-16-18(2)25-21(17-19)23(20-12-10-9-11-13-20)28-29(6,7)24(3,4)5/h9-17,23H,8H2,1-7H3/b15-14+/t23-/m0/s1 |
| InChIKey | COEMAEMKMCHSPL-NSFRLNINSA-N |
| XLogP | 6.08 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.62 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|