C13H14ClFO2 — CID 177493092
ethyl (Z,4R)-4-chloro-4-fluoro-5-phenylpent-2-enoate (PubChem CID 177493092) has the molecular formula C13H14ClFO2 and a molecular weight of 256.70 g/mol. Its IUPAC name is ethyl (Z,4R)-4-chloro-4-fluoro-5-phenylpent-2-enoate.
| Compound Name | ethyl (Z,4R)-4-chloro-4-fluoro-5-phenylpent-2-enoate |
|---|---|
| PubChem CID | 177493092 |
| Molecular Formula | C13H14ClFO2 |
| Molecular Weight | 256.70 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | ethyl (Z,4R)-4-chloro-4-fluoro-5-phenylpent-2-enoate |
| SMILES | CCOC(=O)/C=C\[C@](F)(Cl)Cc1ccccc1 |
| InChI | InChI=1S/C13H14ClFO2/c1-2-17-12(16)8-9-13(14,15)10-11-6-4-3-5-7-11/h3-9H,2,10H2,1H3/b9-8-/t13-/m1/s1 |
| InChIKey | WTURVPYCLLBVRT-LJTDUEICSA-N |
| XLogP | 3.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.70 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|