C16H22O4 — CID 11334934
ethyl (E,4S,5S)-4,5-dihydroxy-4-methyl-7-phenylhept-2-enoate (PubChem CID 11334934) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is ethyl (E,4S,5S)-4,5-dihydroxy-4-methyl-7-phenylhept-2-enoate.
| Compound Name | ethyl (E,4S,5S)-4,5-dihydroxy-4-methyl-7-phenylhept-2-enoate |
|---|---|
| PubChem CID | 11334934 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | ethyl (E,4S,5S)-4,5-dihydroxy-4-methyl-7-phenylhept-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@](C)(O)[C@@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C16H22O4/c1-3-20-15(18)11-12-16(2,19)14(17)10-9-13-7-5-4-6-8-13/h4-8,11-12,14,17,19H,3,9-10H2,1-2H3/b12-11+/t14-,16-/m0/s1 |
| InChIKey | UWHAHXYCGHSWBY-FCBZUWDESA-N |
| XLogP | 1.85 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|