About ethyl (E)-but-2-enoate;styrene
ethyl (E)-but-2-enoate;styrene (PubChem CID 174773304) has the molecular formula C14H18O2
and a molecular weight of 218.30 g/mol. Its IUPAC name is ethyl (E)-but-2-enoate;styrene.
Molecular Properties
| Compound Name | ethyl (E)-but-2-enoate;styrene |
| PubChem CID | 174773304 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | ethyl (E)-but-2-enoate;styrene |
| SMILES | C/C=C/C(=O)OCC.C=Cc1ccccc1 |
| InChI | InChI=1S/C8H8.C6H10O2/c1-2-8-6-4-3-5-7-8;1-3-5-6(7)8-4-2/h2-7H,1H2;3,5H,4H2,1-2H3/b;5-3+ |
| InChIKey | KXWGXBXVLASDKC-GWDXERMASA-N |
| XLogP | 3.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-but-2-enoate;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-but-2-enoate;styrene?
The IUPAC name of ethyl (E)-but-2-enoate;styrene (CID 174773304) is ethyl (E)-but-2-enoate;styrene.
What is the SMILES notation for ethyl (E)-but-2-enoate;styrene?
The canonical SMILES for ethyl (E)-but-2-enoate;styrene is C/C=C/C(=O)OCC.C=Cc1ccccc1.
What is the InChIKey of ethyl (E)-but-2-enoate;styrene?
The InChIKey is KXWGXBXVLASDKC-GWDXERMASA-N. The full InChI is InChI=1S/C8H8.C6H10O2/c1-2-8-6-4-3-5-7-8;1-3-5-6(7)8-4-2/h2-7H,1H2;3,5H,4H2,1-2H3/b;5-3+.
What are the key properties of ethyl (E)-but-2-enoate;styrene?
ethyl (E)-but-2-enoate;styrene has a molecular weight of 218.30 g/mol, XLogP of 3.46, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-but-2-enoate;styrene is sourced from PubChem (CID 174773304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).