C17H22F2O3 — CID 162403593
ethyl (4R,5S)-4-ethenyl-2,2-difluoro-5-hydroxy-7-phenylheptanoate (PubChem CID 162403593) has the molecular formula C17H22F2O3 and a molecular weight of 312.36 g/mol. Its IUPAC name is ethyl (4R,5S)-4-ethenyl-2,2-difluoro-5-hydroxy-7-phenylheptanoate.
| Compound Name | ethyl (4R,5S)-4-ethenyl-2,2-difluoro-5-hydroxy-7-phenylheptanoate |
|---|---|
| PubChem CID | 162403593 |
| Molecular Formula | C17H22F2O3 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | ethyl (4R,5S)-4-ethenyl-2,2-difluoro-5-hydroxy-7-phenylheptanoate |
| SMILES | C=C[C@@H](CC(F)(F)C(=O)OCC)[C@@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C17H22F2O3/c1-3-14(12-17(18,19)16(21)22-4-2)15(20)11-10-13-8-6-5-7-9-13/h3,5-9,14-15,20H,1,4,10-12H2,2H3/t14-,15-/m0/s1 |
| InChIKey | ZVRAPZDKTIZKGP-GJZGRUSLSA-N |
| XLogP | 3.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|