C14H20O2 — CID 10513125
3-ethenyl-6-phenylhexane-1,4-diol (PubChem CID 10513125) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is 3-ethenyl-6-phenylhexane-1,4-diol.
| Compound Name | 3-ethenyl-6-phenylhexane-1,4-diol |
|---|---|
| PubChem CID | 10513125 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 3-ethenyl-6-phenylhexane-1,4-diol |
| SMILES | C=CC(CCO)C(O)CCc1ccccc1 |
| InChI | InChI=1S/C14H20O2/c1-2-13(10-11-15)14(16)9-8-12-6-4-3-5-7-12/h2-7,13-16H,1,8-11H2 |
| InChIKey | LUCLCADKPMRPAN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|