C20H32O2 — CID 71610289
2-non-8-enyl-5-phenylpentane-1,3-diol (PubChem CID 71610289) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is 2-non-8-enyl-5-phenylpentane-1,3-diol.
| Compound Name | 2-non-8-enyl-5-phenylpentane-1,3-diol |
|---|---|
| PubChem CID | 71610289 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 2-non-8-enyl-5-phenylpentane-1,3-diol |
| SMILES | C=CCCCCCCCC(CO)C(O)CCc1ccccc1 |
| InChI | InChI=1S/C20H32O2/c1-2-3-4-5-6-7-11-14-19(17-21)20(22)16-15-18-12-9-8-10-13-18/h2,8-10,12-13,19-22H,1,3-7,11,14-17H2 |
| InChIKey | KFVFLWYNAHQVFA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|