C17H26O — CID 129208027
2-ethenyl-3-methyl-8-phenyloctan-1-ol (PubChem CID 129208027) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is 2-ethenyl-3-methyl-8-phenyloctan-1-ol.
| Compound Name | 2-ethenyl-3-methyl-8-phenyloctan-1-ol |
|---|---|
| PubChem CID | 129208027 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 2-ethenyl-3-methyl-8-phenyloctan-1-ol |
| SMILES | C=CC(CO)C(C)CCCCCc1ccccc1 |
| InChI | InChI=1S/C17H26O/c1-3-17(14-18)15(2)10-6-4-7-11-16-12-8-5-9-13-16/h3,5,8-9,12-13,15,17-18H,1,4,6-7,10-11,14H2,2H3 |
| InChIKey | YNPWIFGMCFIPDK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|