C21H26O3 — CID 138976247
(2R,3S)-5-phenyl-2-[(E)-3-phenylmethoxyprop-1-enyl]pentane-1,3-diol (PubChem CID 138976247) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is (2R,3S)-5-phenyl-2-[(E)-3-phenylmethoxyprop-1-enyl]pentane-1,3-diol.
| Compound Name | (2R,3S)-5-phenyl-2-[(E)-3-phenylmethoxyprop-1-enyl]pentane-1,3-diol |
|---|---|
| PubChem CID | 138976247 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | (2R,3S)-5-phenyl-2-[(E)-3-phenylmethoxyprop-1-enyl]pentane-1,3-diol |
| SMILES | OC[C@@H](/C=C/COCc1ccccc1)[C@@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C21H26O3/c22-16-20(21(23)14-13-18-8-3-1-4-9-18)12-7-15-24-17-19-10-5-2-6-11-19/h1-12,20-23H,13-17H2/b12-7+/t20-,21+/m1/s1 |
| InChIKey | ZDEQSMSPDCASNH-GDZYHKTMSA-N |
| XLogP | 3.36 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|