C14H18O4 — CID 56646956
(2R)-7-phenylmethoxyhept-5-yne-1,2,3-triol (PubChem CID 56646956) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is (2R)-7-phenylmethoxyhept-5-yne-1,2,3-triol.
| Compound Name | (2R)-7-phenylmethoxyhept-5-yne-1,2,3-triol |
|---|---|
| PubChem CID | 56646956 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (2R)-7-phenylmethoxyhept-5-yne-1,2,3-triol |
| SMILES | OC[C@@H](O)C(O)CC#CCOCc1ccccc1 |
| InChI | InChI=1S/C14H18O4/c15-10-14(17)13(16)8-4-5-9-18-11-12-6-2-1-3-7-12/h1-3,6-7,13-17H,8-11H2/t13?,14-/m1/s1 |
| InChIKey | ZTIZNADIUFWPSJ-ARLHGKGLSA-N |
| XLogP | 0.31 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|