C13H16O3 — CID 56646910
6-phenylmethoxyhex-4-yne-1,2-diol (PubChem CID 56646910) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is 6-phenylmethoxyhex-4-yne-1,2-diol.
| Compound Name | 6-phenylmethoxyhex-4-yne-1,2-diol |
|---|---|
| PubChem CID | 56646910 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 6-phenylmethoxyhex-4-yne-1,2-diol |
| SMILES | OCC(O)CC#CCOCc1ccccc1 |
| InChI | InChI=1S/C13H16O3/c14-10-13(15)8-4-5-9-16-11-12-6-2-1-3-7-12/h1-3,6-7,13-15H,8-11H2 |
| InChIKey | RSGPKPJCZALMFF-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|