C21H20O2 — CID 10930944
7-phenylmethoxyhepta-2,5-diynoxymethylbenzene (PubChem CID 10930944) has the molecular formula C21H20O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 7-phenylmethoxyhepta-2,5-diynoxymethylbenzene.
| Compound Name | 7-phenylmethoxyhepta-2,5-diynoxymethylbenzene |
|---|---|
| PubChem CID | 10930944 |
| Molecular Formula | C21H20O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 7-phenylmethoxyhepta-2,5-diynoxymethylbenzene |
| SMILES | C(#CCOCc1ccccc1)CC#CCOCc1ccccc1 |
| InChI | InChI=1S/C21H20O2/c1(2-10-16-22-18-20-12-6-4-7-13-20)3-11-17-23-19-21-14-8-5-9-15-21/h4-9,12-15H,1,16-19H2 |
| InChIKey | JVAKOOKFWIUTPC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|